C14H21N — CID 4562956
2-tert-butyl-4,7-dimethyl-2,3-dihydro-1H-indole (PubChem CID 4562956) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-tert-butyl-4,7-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | 2-tert-butyl-4,7-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4562956 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-tert-butyl-4,7-dimethyl-2,3-dihydro-1H-indole |
| SMILES | Cc1ccc(C)c2c1CC(C(C)(C)C)N2 |
| InChI | InChI=1S/C14H21N/c1-9-6-7-10(2)13-11(9)8-12(15-13)14(3,4)5/h6-7,12,15H,8H2,1-5H3 |
| InChIKey | BQDXWDWLPSADML-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |