C21H29N3O6 — CID 4570639
N-[[4-(dimethylamino)phenyl]methylideneamino]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 4570639) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methylideneamino]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 4570639 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)C2OC3OC(C)(C)OC3C3OC(C)(C)OC23)cc1 |
| InChI | InChI=1S/C21H29N3O6/c1-20(2)27-14-15(28-20)17-19(30-21(3,4)29-17)26-16(14)18(25)23-22-11-12-7-9-13(10-8-12)24(5)6/h7-11,14-17,19H,1-6H3,(H,23,25) |
| InChIKey | FNBJDEMDMRAPIB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|