C23H23N3O5S2 — CID 4579077
(2-phenyl-1,3-thiazol-4-yl)methyl 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 4579077) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 4579077 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)OCc3csc(-c4ccccc4)n3)c2)CC1 |
| InChI | InChI=1S/C23H23N3O5S2/c1-17(27)25-10-12-26(13-11-25)33(29,30)21-9-5-8-19(14-21)23(28)31-15-20-16-32-22(24-20)18-6-3-2-4-7-18/h2-9,14,16H,10-13,15H2,1H3 |
| InChIKey | YSFTVJNRQRWKJO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |