C8H9F7N2O2 — CID 4589976
2,2,3,3,4,4,4-heptafluoro-N-morpholin-4-ylbutanamide (PubChem CID 4589976) has the molecular formula C8H9F7N2O2 and a molecular weight of 298.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-morpholin-4-ylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 4589976 |
| Molecular Formula | C8H9F7N2O2 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-morpholin-4-ylbutanamide |
| SMILES | O=C(NN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F7N2O2/c9-6(10,7(11,12)8(13,14)15)5(18)16-17-1-3-19-4-2-17/h1-4H2,(H,16,18) |
| InChIKey | ONXXKJMYBSQXHL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|