C9H9F9N2O2 — CID 4603368
2,2,3,3,4,4,5,5,5-nonafluoro-N-morpholin-4-ylpentanamide (PubChem CID 4603368) has the molecular formula C9H9F9N2O2 and a molecular weight of 348.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-morpholin-4-ylpentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-morpholin-4-ylpentanamide |
|---|---|
| PubChem CID | 4603368 |
| Molecular Formula | C9H9F9N2O2 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-morpholin-4-ylpentanamide |
| SMILES | O=C(NN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9N2O2/c10-6(11,5(21)19-20-1-3-22-4-2-20)7(12,13)8(14,15)9(16,17)18/h1-4H2,(H,19,21) |
| InChIKey | VGPRURRHRMEASH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|