C20H29N3O3 — CID 46062529
1-(3,5-dimethylphenyl)-3-[4-(2-methoxyethyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 46062529) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[4-(2-methoxyethyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[4-(2-methoxyethyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 46062529 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[4-(2-methoxyethyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COCCN1CCN(C(=O)C2CCN(c3cc(C)cc(C)c3)C2=O)CC1 |
| InChI | InChI=1S/C20H29N3O3/c1-15-12-16(2)14-17(13-15)23-5-4-18(20(23)25)19(24)22-8-6-21(7-9-22)10-11-26-3/h12-14,18H,4-11H2,1-3H3 |
| InChIKey | KTYXEQNZHYGQSK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|