C23H17F7N2O3 — CID 46090566
N-[3-[6-(2,5-dimethoxyphenyl)-2-pyridinyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 46090566) has the molecular formula C23H17F7N2O3 and a molecular weight of 502.39 g/mol. Its IUPAC name is N-[3-[6-(2,5-dimethoxyphenyl)-2-pyridinyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[3-[6-(2,5-dimethoxyphenyl)-2-pyridinyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 46090566 |
| Molecular Formula | C23H17F7N2O3 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N-[3-[6-(2,5-dimethoxyphenyl)-2-pyridinyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | COc1ccc(OC)c(-c2cccc(-c3cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C23H17F7N2O3/c1-34-15-9-10-19(35-2)16(12-15)18-8-4-7-17(32-18)13-5-3-6-14(11-13)31-20(33)21(24,25)22(26,27)23(28,29)30/h3-12H,1-2H3,(H,31,33) |
| InChIKey | YEXRTTNJEZXQNN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|