C24H21N2O5- — CID 4610151
3-hydroxy-2-[[2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]acetyl]amino]-3-phenylpropanoate (PubChem CID 4610151) has the molecular formula C24H21N2O5- and a molecular weight of 417.44 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]acetyl]amino]-3-phenylpropanoate.
| Compound Name | 3-hydroxy-2-[[2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 4610151 |
| Molecular Formula | C24H21N2O5- |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 3-hydroxy-2-[[2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]acetyl]amino]-3-phenylpropanoate |
| SMILES | O=C(Cc1ccc(/N=C/c2ccccc2O)cc1)NC(C(=O)[O-])C(O)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O5/c27-20-9-5-4-8-18(20)15-25-19-12-10-16(11-13-19)14-21(28)26-22(24(30)31)23(29)17-6-2-1-3-7-17/h1-13,15,22-23,27,29H,14H2,(H,26,28)(H,30,31)/p-1/b25-15+ |
| InChIKey | JYZFIZWUQUAQIB-MFKUBSTISA-M |
| XLogP | 1.65 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|