C17H16NNaO6 — CID 23682243
sodium (2S,3R)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-[(2-phenylacetyl)amino]propanoate (PubChem CID 23682243) has the molecular formula C17H16NNaO6 and a molecular weight of 353.31 g/mol. Its IUPAC name is sodium (2S,3R)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-[(2-phenylacetyl)amino]propanoate.
| Compound Name | sodium (2S,3R)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-[(2-phenylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 23682243 |
| Molecular Formula | C17H16NNaO6 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | sodium (2S,3R)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-[(2-phenylacetyl)amino]propanoate |
| SMILES | O=C(Cc1ccccc1)N[C@H](C(=O)[O-])[C@H](O)c1ccc(O)c(O)c1.[Na+] |
| InChI | InChI=1S/C17H17NO6.Na/c19-12-7-6-11(9-13(12)20)16(22)15(17(23)24)18-14(21)8-10-4-2-1-3-5-10;/h1-7,9,15-16,19-20,22H,8H2,(H,18,21)(H,23,24);/q;+1/p-1/t15-,16+;/m0./s1 |
| InChIKey | QTWGWTDLZXHBFG-IDVLALEDSA-M |
| XLogP | -3.39 |
| TPSA | 129.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|