C22H19ClF3N5O4S — CID 46131995
4-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 46131995) has the molecular formula C22H19ClF3N5O4S and a molecular weight of 541.94 g/mol. Its IUPAC name is 4-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 4-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 46131995 |
| Molecular Formula | C22H19ClF3N5O4S |
| Molecular Weight | 541.94 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | 4-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3ccc(Cl)c([N+](=O)[O-])c3)CC2)nc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C22H19ClF3N5O4S/c1-14-12-20(28-21(27-14)15-2-4-16(5-3-15)22(24,25)26)29-8-10-30(11-9-29)36(34,35)17-6-7-18(23)19(13-17)31(32)33/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | RHILXYRQWSWBEA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|