C35H30N4O4 — CID 4616625
5-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 4616625) has the molecular formula C35H30N4O4 and a molecular weight of 570.65 g/mol. Its IUPAC name is 5-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4616625 |
| Molecular Formula | C35H30N4O4 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 5-[N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc2[nH]cc(CC/N=C(\c3ccc(C)cc3)C3C(=O)N(c4ccccc4)C(=O)N(c4ccccc4)C3=O)c2c1 |
| InChI | InChI=1S/C35H30N4O4/c1-23-13-15-24(16-14-23)32(36-20-19-25-22-37-30-18-17-28(43-2)21-29(25)30)31-33(40)38(26-9-5-3-6-10-26)35(42)39(34(31)41)27-11-7-4-8-12-27/h3-18,21-22,31,37H,19-20H2,1-2H3/b36-32+ |
| InChIKey | QBZRVORDWOISNZ-WIKZRCHHSA-N |
| XLogP | 6.33 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|