C24H23FN4O3 — CID 1497584
5-[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 1497584) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is 5-[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1497584 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 5-[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-C-(4-methylphenyl)carbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(/C(=N\CCc2c[nH]c3ccc(F)cc23)C2C(=O)N(C)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C24H23FN4O3/c1-14-4-6-15(7-5-14)21(20-22(30)28(2)24(32)29(3)23(20)31)26-11-10-16-13-27-19-9-8-17(25)12-18(16)19/h4-9,12-13,20,27H,10-11H2,1-3H3/b26-21+ |
| InChIKey | RDPLISAXYXEFEM-YYADALCUSA-N |
| XLogP | 3.31 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|