C35H47N6O7S2+ — CID 46174670
4-[2-[[(2Z)-2-[(2E,4E)-5-[5-(2-aminoethylsulfamoyl)-1,3,3-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethylindol-5-yl]sulfonylamino]ethylamino]-4-oxobutanoic acid (PubChem CID 46174670) has the molecular formula C35H47N6O7S2+ and a molecular weight of 727.93 g/mol. Its IUPAC name is 4-[2-[[(2Z)-2-[(2E,4E)-5-[5-(2-aminoethylsulfamoyl)-1,3,3-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethylindol-5-yl]sulfonylamino]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[[(2Z)-2-[(2E,4E)-5-[5-(2-aminoethylsulfamoyl)-1,3,3-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethylindol-5-yl]sulfonylamino]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 46174670 |
| Molecular Formula | C35H47N6O7S2+ |
| Molecular Weight | 727.93 g/mol |
| Exact Mass | 727.29 |
| IUPAC Name | 4-[2-[[(2Z)-2-[(2E,4E)-5-[5-(2-aminoethylsulfamoyl)-1,3,3-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethylindol-5-yl]sulfonylamino]ethylamino]-4-oxobutanoic acid |
| SMILES | CN1/C(=C\C=C\C=C\C2=[N+](C)c3ccc(S(=O)(=O)NCCN)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)NCCNC(=O)CCC(=O)O)ccc21 |
| InChI | InChI=1S/C35H46N6O7S2/c1-34(2)26-22-24(49(45,46)38-19-18-36)12-14-28(26)40(5)30(34)10-8-7-9-11-31-35(3,4)27-23-25(13-15-29(27)41(31)6)50(47,48)39-21-20-37-32(42)16-17-33(43)44/h7-15,22-23,38-39H,16-21,36H2,1-6H3,(H-,37,42,43,44)/p+1 |
| InChIKey | VJNMUFUNGFBJMB-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 191.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.93 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|