C23H25N5O5 — CID 46180687
methyl 8-[3-[1-(3-nitrophenyl)triazol-4-yl]anilino]-8-oxooctanoate (PubChem CID 46180687) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is methyl 8-[3-[1-(3-nitrophenyl)triazol-4-yl]anilino]-8-oxooctanoate.
| Compound Name | methyl 8-[3-[1-(3-nitrophenyl)triazol-4-yl]anilino]-8-oxooctanoate |
|---|---|
| PubChem CID | 46180687 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | methyl 8-[3-[1-(3-nitrophenyl)triazol-4-yl]anilino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)Nc1cccc(-c2cn(-c3cccc([N+](=O)[O-])c3)nn2)c1 |
| InChI | InChI=1S/C23H25N5O5/c1-33-23(30)13-5-3-2-4-12-22(29)24-18-9-6-8-17(14-18)21-16-27(26-25-21)19-10-7-11-20(15-19)28(31)32/h6-11,14-16H,2-5,12-13H2,1H3,(H,24,29) |
| InChIKey | GFIADYDKVXFCGH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|