C23H22F6N4O — CID 162538468
N-[3-[1-[3,5-bis(trifluoromethyl)phenyl]triazol-4-yl]phenyl]heptanamide (PubChem CID 162538468) has the molecular formula C23H22F6N4O and a molecular weight of 484.44 g/mol. Its IUPAC name is N-[3-[1-[3,5-bis(trifluoromethyl)phenyl]triazol-4-yl]phenyl]heptanamide.
| Compound Name | N-[3-[1-[3,5-bis(trifluoromethyl)phenyl]triazol-4-yl]phenyl]heptanamide |
|---|---|
| PubChem CID | 162538468 |
| Molecular Formula | C23H22F6N4O |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[3-[1-[3,5-bis(trifluoromethyl)phenyl]triazol-4-yl]phenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1cccc(-c2cn(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nn2)c1 |
| InChI | InChI=1S/C23H22F6N4O/c1-2-3-4-5-9-21(34)30-18-8-6-7-15(10-18)20-14-33(32-31-20)19-12-16(22(24,25)26)11-17(13-19)23(27,28)29/h6-8,10-14H,2-5,9H2,1H3,(H,30,34) |
| InChIKey | OIMXVAGSQBVNKQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|