C16H22O5 — CID 46192637
[5-butanoyloxy-4-oxo-2-[(E)-prop-1-enyl]cyclopent-2-en-1-yl] butanoate (PubChem CID 46192637) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [5-butanoyloxy-4-oxo-2-[(E)-prop-1-enyl]cyclopent-2-en-1-yl] butanoate.
| Compound Name | [5-butanoyloxy-4-oxo-2-[(E)-prop-1-enyl]cyclopent-2-en-1-yl] butanoate |
|---|---|
| PubChem CID | 46192637 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [5-butanoyloxy-4-oxo-2-[(E)-prop-1-enyl]cyclopent-2-en-1-yl] butanoate |
| SMILES | C/C=C/C1=CC(=O)C(OC(=O)CCC)C1OC(=O)CCC |
| InChI | InChI=1S/C16H22O5/c1-4-7-11-10-12(17)16(21-14(19)9-6-3)15(11)20-13(18)8-5-2/h4,7,10,15-16H,5-6,8-9H2,1-3H3/b7-4+ |
| InChIKey | YWAKCUICJLTVGZ-QPJJXVBHSA-N |
| XLogP | 2.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |