C30H34N2O6S — CID 46193294
(1R,12S,13R,17R)-3-benzyl-7-methoxy-15,15-dimethyl-11-(4-methylphenyl)sulfonyl-14,16,18-trioxa-3,11-diazatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene (PubChem CID 46193294) has the molecular formula C30H34N2O6S and a molecular weight of 550.68 g/mol. Its IUPAC name is (1R,12S,13R,17R)-3-benzyl-7-methoxy-15,15-dimethyl-11-(4-methylphenyl)sulfonyl-14,16,18-trioxa-3,11-diazatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene.
| Compound Name | (1R,12S,13R,17R)-3-benzyl-7-methoxy-15,15-dimethyl-11-(4-methylphenyl)sulfonyl-14,16,18-trioxa-3,11-diazatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene |
|---|---|
| PubChem CID | 46193294 |
| Molecular Formula | C30H34N2O6S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | (1R,12S,13R,17R)-3-benzyl-7-methoxy-15,15-dimethyl-11-(4-methylphenyl)sulfonyl-14,16,18-trioxa-3,11-diazatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene |
| SMILES | COc1ccc2c(c1)CN(S(=O)(=O)c1ccc(C)cc1)[C@@H]1[C@H]3OC(C)(C)O[C@H]3O[C@@H]1CN2Cc1ccccc1 |
| InChI | InChI=1S/C30H34N2O6S/c1-20-10-13-24(14-11-20)39(33,34)32-18-22-16-23(35-4)12-15-25(22)31(17-21-8-6-5-7-9-21)19-26-27(32)28-29(36-26)38-30(2,3)37-28/h5-16,26-29H,17-19H2,1-4H3/t26-,27+,28-,29-/m1/s1 |
| InChIKey | KSJGWIOVXITWNS-VJLHXPKFSA-N |
| XLogP | 4.46 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|