C32H47ClNO5P — CID 46203837
ditert-butyl [4-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 46203837) has the molecular formula C32H47ClNO5P and a molecular weight of 592.16 g/mol. Its IUPAC name is ditert-butyl [4-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [4-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 46203837 |
| Molecular Formula | C32H47ClNO5P |
| Molecular Weight | 592.16 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | ditert-butyl [4-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CCCCCc1ccc(-c2ccc(CCC3(COP(=O)(OC(C)(C)C)OC(C)(C)C)COC(C)=N3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C32H47ClNO5P/c1-9-10-11-12-25-13-15-26(16-14-25)28-18-17-27(29(33)21-28)19-20-32(22-36-24(2)34-32)23-37-40(35,38-30(3,4)5)39-31(6,7)8/h13-18,21H,9-12,19-20,22-23H2,1-8H3 |
| InChIKey | QOYXGYMAHGKMLK-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.16 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|