C23H28ClNO2 — CID 143349383
[4-[2-[2-chloro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol (PubChem CID 143349383) has the molecular formula C23H28ClNO2 and a molecular weight of 385.94 g/mol. Its IUPAC name is [4-[2-[2-chloro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol.
| Compound Name | [4-[2-[2-chloro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 143349383 |
| Molecular Formula | C23H28ClNO2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | [4-[2-[2-chloro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol |
| SMILES | CC1=NC(CO)(CCc2ccc(CCCCc3ccccc3)cc2Cl)CO1 |
| InChI | InChI=1S/C23H28ClNO2/c1-18-25-23(16-26,17-27-18)14-13-21-12-11-20(15-22(21)24)10-6-5-9-19-7-3-2-4-8-19/h2-4,7-8,11-12,15,26H,5-6,9-10,13-14,16-17H2,1H3 |
| InChIKey | MHTKBCWEWKGINJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|