C21H28ClN3O4S — CID 46205709
2-[(4-chloronaphthalen-1-yl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide (PubChem CID 46205709) has the molecular formula C21H28ClN3O4S and a molecular weight of 453.99 g/mol. Its IUPAC name is 2-[(4-chloronaphthalen-1-yl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide.
| Compound Name | 2-[(4-chloronaphthalen-1-yl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide |
|---|---|
| PubChem CID | 46205709 |
| Molecular Formula | C21H28ClN3O4S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[(4-chloronaphthalen-1-yl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide |
| SMILES | CC(C)NC(=O)CCC(NS(=O)(=O)c1ccc(Cl)c2ccccc12)C(=O)NC(C)C |
| InChI | InChI=1S/C21H28ClN3O4S/c1-13(2)23-20(26)12-10-18(21(27)24-14(3)4)25-30(28,29)19-11-9-17(22)15-7-5-6-8-16(15)19/h5-9,11,13-14,18,25H,10,12H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | BWYSWTMFHOATOM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |