C24H23N3O2 — CID 46207795
7-[2,2,3,3,5,5,6,6-octadeuterio-4-[[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 46207795) has the molecular formula C24H23N3O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 7-[2,2,3,3,5,5,6,6-octadeuterio-4-[[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-[2,2,3,3,5,5,6,6-octadeuterio-4-[[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 46207795 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 7-[2,2,3,3,5,5,6,6-octadeuterio-4-[[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(CN3C([2H])([2H])C([2H])([2H])N(c4cccc5[nH]c(=O)oc45)C([2H])([2H])C3([2H])[2H])c2)c([2H])c1[2H] |
| InChI | InChI=1S/C24H23N3O2/c28-24-25-21-10-5-11-22(23(21)29-24)27-14-12-26(13-15-27)17-18-6-4-9-20(16-18)19-7-2-1-3-8-19/h1-11,16H,12-15,17H2,(H,25,28)/i1D,2D,3D,7D,8D,12D2,13D2,14D2,15D2 |
| InChIKey | CYGODHVAJQTCBG-GDHHCEHCSA-N |
| XLogP | 4.11 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |