C11H11ClN2O — CID 46217575
6-chloro-3-ethyl-4-methylidene-1H-quinazolin-2-one (PubChem CID 46217575) has the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. Its IUPAC name is 6-chloro-3-ethyl-4-methylidene-1H-quinazolin-2-one.
| Compound Name | 6-chloro-3-ethyl-4-methylidene-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 46217575 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6-chloro-3-ethyl-4-methylidene-1H-quinazolin-2-one |
| SMILES | C=C1c2cc(Cl)ccc2NC(=O)N1CC |
| InChI | InChI=1S/C11H11ClN2O/c1-3-14-7(2)9-6-8(12)4-5-10(9)13-11(14)15/h4-6H,2-3H2,1H3,(H,13,15) |
| InChIKey | WJBYEQADPLLGCE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |