C12H9BrClNO2 — CID 71551352
3-(1-bromoethenyl)-6-chloro-3-methyl-1H-quinoline-2,4-dione (PubChem CID 71551352) has the molecular formula C12H9BrClNO2 and a molecular weight of 314.57 g/mol. Its IUPAC name is 3-(1-bromoethenyl)-6-chloro-3-methyl-1H-quinoline-2,4-dione.
| Compound Name | 3-(1-bromoethenyl)-6-chloro-3-methyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 71551352 |
| Molecular Formula | C12H9BrClNO2 |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 3-(1-bromoethenyl)-6-chloro-3-methyl-1H-quinoline-2,4-dione |
| SMILES | C=C(Br)C1(C)C(=O)Nc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C12H9BrClNO2/c1-6(13)12(2)10(16)8-5-7(14)3-4-9(8)15-11(12)17/h3-5H,1H2,2H3,(H,15,17) |
| InChIKey | WEDLARGIMNSKKM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|