C17H14ClIN2O2 — CID 70945480
7-chloro-3-[(4-iodophenyl)methyl]-3-methyl-1,4-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 70945480) has the molecular formula C17H14ClIN2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is 7-chloro-3-[(4-iodophenyl)methyl]-3-methyl-1,4-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | 7-chloro-3-[(4-iodophenyl)methyl]-3-methyl-1,4-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 70945480 |
| Molecular Formula | C17H14ClIN2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 7-chloro-3-[(4-iodophenyl)methyl]-3-methyl-1,4-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | CC1(Cc2ccc(I)cc2)NC(=O)c2cc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C17H14ClIN2O2/c1-17(9-10-2-5-12(19)6-3-10)16(23)20-14-7-4-11(18)8-13(14)15(22)21-17/h2-8H,9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | XUSJUIJPUKMLFJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|