C18H17ClINO2 — CID 147905218
(3S)-8-chloro-3-[(4-iodocyclohexa-2,4-dien-1-yl)methyl]-3-methyl-2,5-dihydro-2-benzazepine-1,4-dione (PubChem CID 147905218) has the molecular formula C18H17ClINO2 and a molecular weight of 441.70 g/mol. Its IUPAC name is (3S)-8-chloro-3-[(4-iodocyclohexa-2,4-dien-1-yl)methyl]-3-methyl-2,5-dihydro-2-benzazepine-1,4-dione.
| Compound Name | (3S)-8-chloro-3-[(4-iodocyclohexa-2,4-dien-1-yl)methyl]-3-methyl-2,5-dihydro-2-benzazepine-1,4-dione |
|---|---|
| PubChem CID | 147905218 |
| Molecular Formula | C18H17ClINO2 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | (3S)-8-chloro-3-[(4-iodocyclohexa-2,4-dien-1-yl)methyl]-3-methyl-2,5-dihydro-2-benzazepine-1,4-dione |
| SMILES | C[C@@]1(CC2C=CC(I)=CC2)NC(=O)c2cc(Cl)ccc2CC1=O |
| InChI | InChI=1S/C18H17ClINO2/c1-18(10-11-2-6-14(20)7-3-11)16(22)8-12-4-5-13(19)9-15(12)17(23)21-18/h2,4-7,9,11H,3,8,10H2,1H3,(H,21,23)/t11?,18-/m0/s1 |
| InChIKey | IFAXRKZKZRTDJY-MCEAHNFKSA-N |
| XLogP | 4.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|