C13H20O2SSi — CID 46217615
4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-sulfanylidenecyclohexa-2,4-dien-1-one (PubChem CID 46217615) has the molecular formula C13H20O2SSi and a molecular weight of 268.45 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-sulfanylidenecyclohexa-2,4-dien-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-sulfanylidenecyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 46217615 |
| Molecular Formula | C13H20O2SSi |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-sulfanylidenecyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(=S)C1=O |
| InChI | InChI=1S/C13H20O2SSi/c1-9-7-10(8-11(16)12(9)14)15-17(5,6)13(2,3)4/h7-8H,1-6H3 |
| InChIKey | MVDZLDLNBSEZBO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|