C33H65NO5Si4 — CID 46217791
(1R,5S)-1-hydroxy-6,6-dimethyl-1-(4-nitrophenyl)-5-tris(triethylsilyl)silyloxyheptan-3-one (PubChem CID 46217791) has the molecular formula C33H65NO5Si4 and a molecular weight of 668.23 g/mol. Its IUPAC name is (1R,5S)-1-hydroxy-6,6-dimethyl-1-(4-nitrophenyl)-5-tris(triethylsilyl)silyloxyheptan-3-one.
| Compound Name | (1R,5S)-1-hydroxy-6,6-dimethyl-1-(4-nitrophenyl)-5-tris(triethylsilyl)silyloxyheptan-3-one |
|---|---|
| PubChem CID | 46217791 |
| Molecular Formula | C33H65NO5Si4 |
| Molecular Weight | 668.23 g/mol |
| Exact Mass | 667.39 |
| IUPAC Name | (1R,5S)-1-hydroxy-6,6-dimethyl-1-(4-nitrophenyl)-5-tris(triethylsilyl)silyloxyheptan-3-one |
| SMILES | CC[Si](CC)(CC)[Si](O[C@@H](CC(=O)C[C@@H](O)c1ccc([N+](=O)[O-])cc1)C(C)(C)C)([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H65NO5Si4/c1-13-40(14-2,15-3)43(41(16-4,17-5)18-6,42(19-7,20-8)21-9)39-32(33(10,11)12)27-30(35)26-31(36)28-22-24-29(25-23-28)34(37)38/h22-25,31-32,36H,13-21,26-27H2,1-12H3/t31-,32+/m1/s1 |
| InChIKey | MMFHCZMHBHONEE-ZWXJPIIXSA-N |
| XLogP | 10.11 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.23 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|