C34H38N6O6 — CID 46227851
dibenzyl (2S)-2-[[2-[cyclopropyl-[9-(oxan-2-yl)purin-6-yl]amino]acetyl]amino]pentanedioate (PubChem CID 46227851) has the molecular formula C34H38N6O6 and a molecular weight of 626.71 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[2-[cyclopropyl-[9-(oxan-2-yl)purin-6-yl]amino]acetyl]amino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[2-[cyclopropyl-[9-(oxan-2-yl)purin-6-yl]amino]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 46227851 |
| Molecular Formula | C34H38N6O6 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | dibenzyl (2S)-2-[[2-[cyclopropyl-[9-(oxan-2-yl)purin-6-yl]amino]acetyl]amino]pentanedioate |
| SMILES | O=C(CN(c1ncnc2c1ncn2C1CCCCO1)C1CC1)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H38N6O6/c41-28(19-39(26-14-15-26)32-31-33(36-22-35-32)40(23-37-31)29-13-7-8-18-44-29)38-27(34(43)46-21-25-11-5-2-6-12-25)16-17-30(42)45-20-24-9-3-1-4-10-24/h1-6,9-12,22-23,26-27,29H,7-8,13-21H2,(H,38,41)/t27-,29?/m0/s1 |
| InChIKey | BORLZTGGSOWDBJ-BVOOQYFDSA-N |
| XLogP | 4.25 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |