C21H18Br2N2O3 — CID 46229408
1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylurea (PubChem CID 46229408) has the molecular formula C21H18Br2N2O3 and a molecular weight of 506.19 g/mol. Its IUPAC name is 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylurea.
| Compound Name | 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 46229408 |
| Molecular Formula | C21H18Br2N2O3 |
| Molecular Weight | 506.19 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | 1-[(3,5-dibromo-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccc(O)cc1)Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C21H18Br2N2O3/c22-16-10-15(20(27)19(23)11-16)13-25(12-14-6-8-18(26)9-7-14)21(28)24-17-4-2-1-3-5-17/h1-11,26-27H,12-13H2,(H,24,28) |
| InChIKey | YSWRUZSGHZDWJW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.19 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|