C22H25ClN2OS — CID 46230741
1-[1-tert-butylsulfanyl-2-(4-chlorophenyl)-2-phenylmethoxyethyl]imidazole (PubChem CID 46230741) has the molecular formula C22H25ClN2OS and a molecular weight of 400.98 g/mol. Its IUPAC name is 1-[1-tert-butylsulfanyl-2-(4-chlorophenyl)-2-phenylmethoxyethyl]imidazole.
| Compound Name | 1-[1-tert-butylsulfanyl-2-(4-chlorophenyl)-2-phenylmethoxyethyl]imidazole |
|---|---|
| PubChem CID | 46230741 |
| Molecular Formula | C22H25ClN2OS |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-[1-tert-butylsulfanyl-2-(4-chlorophenyl)-2-phenylmethoxyethyl]imidazole |
| SMILES | CC(C)(C)SC(C(OCc1ccccc1)c1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C22H25ClN2OS/c1-22(2,3)27-21(25-14-13-24-16-25)20(18-9-11-19(23)12-10-18)26-15-17-7-5-4-6-8-17/h4-14,16,20-21H,15H2,1-3H3 |
| InChIKey | LINMDIHWXVNQQT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |