C20H14Cl4N2O2 — CID 70501168
1-[1-chloro-2-(4-chlorophenyl)-2-[(4,6-dichloro-1-benzofuran-3-yl)methoxy]ethyl]imidazole (PubChem CID 70501168) has the molecular formula C20H14Cl4N2O2 and a molecular weight of 456.16 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-chlorophenyl)-2-[(4,6-dichloro-1-benzofuran-3-yl)methoxy]ethyl]imidazole.
| Compound Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(4,6-dichloro-1-benzofuran-3-yl)methoxy]ethyl]imidazole |
|---|---|
| PubChem CID | 70501168 |
| Molecular Formula | C20H14Cl4N2O2 |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(4,6-dichloro-1-benzofuran-3-yl)methoxy]ethyl]imidazole |
| SMILES | Clc1ccc(C(OCc2coc3cc(Cl)cc(Cl)c23)C(Cl)n2ccnc2)cc1 |
| InChI | InChI=1S/C20H14Cl4N2O2/c21-14-3-1-12(2-4-14)19(20(24)26-6-5-25-11-26)28-10-13-9-27-17-8-15(22)7-16(23)18(13)17/h1-9,11,19-20H,10H2 |
| InChIKey | YEERUTPUQDYBNG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|