C23H18ClF3N4O2 — CID 46232424
4-chloro-1-[[4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]methyl]indole-2,3-dione (PubChem CID 46232424) has the molecular formula C23H18ClF3N4O2 and a molecular weight of 474.87 g/mol. Its IUPAC name is 4-chloro-1-[[4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]methyl]indole-2,3-dione.
| Compound Name | 4-chloro-1-[[4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 46232424 |
| Molecular Formula | C23H18ClF3N4O2 |
| Molecular Weight | 474.87 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 4-chloro-1-[[4-[7-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCN(c3ccnc4cc(C(F)(F)F)ccc34)CC2)c2cccc(Cl)c21 |
| InChI | InChI=1S/C23H18ClF3N4O2/c24-16-2-1-3-19-20(16)21(32)22(33)31(19)13-29-8-10-30(11-9-29)18-6-7-28-17-12-14(23(25,26)27)4-5-15(17)18/h1-7,12H,8-11,13H2 |
| InChIKey | LJQHHHMSBYEMSB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|