C14H24O4 — CID 46242673
(E)-2-(3,3-diethoxypropyl)hept-2-enedial (PubChem CID 46242673) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (E)-2-(3,3-diethoxypropyl)hept-2-enedial.
| Compound Name | (E)-2-(3,3-diethoxypropyl)hept-2-enedial |
|---|---|
| PubChem CID | 46242673 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (E)-2-(3,3-diethoxypropyl)hept-2-enedial |
| SMILES | CCOC(CC/C(C=O)=C\CCCC=O)OCC |
| InChI | InChI=1S/C14H24O4/c1-3-17-14(18-4-2)10-9-13(12-16)8-6-5-7-11-15/h8,11-12,14H,3-7,9-10H2,1-2H3/b13-8+ |
| InChIKey | PEDRFMNWPLTZPX-MDWZMJQESA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|