C15H17NO3S — CID 46243616
(3S)-3-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]thian-4-one (PubChem CID 46243616) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is (3S)-3-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]thian-4-one.
| Compound Name | (3S)-3-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]thian-4-one |
|---|---|
| PubChem CID | 46243616 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (3S)-3-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]thian-4-one |
| SMILES | O=C1CCSC[C@H]1[C@H](/C=C/c1ccccc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C15H17NO3S/c17-15-8-9-20-11-14(15)13(10-16(18)19)7-6-12-4-2-1-3-5-12/h1-7,13-14H,8-11H2/b7-6+/t13-,14+/m1/s1 |
| InChIKey | OLRQWWFIPAPONZ-AFJNRPGYSA-N |
| XLogP | 2.91 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|