C22H24ClFN4O3 — CID 46243782
N-(3-chloro-4-fluorophenyl)-2,5,8-trideuterio-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 46243782) has the molecular formula C22H24ClFN4O3 and a molecular weight of 449.93 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2,5,8-trideuterio-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2,5,8-trideuterio-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 46243782 |
| Molecular Formula | C22H24ClFN4O3 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2,5,8-trideuterio-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | [2H]c1nc(Nc2ccc(F)c(Cl)c2)c2c([2H])c(OCCCN3CCOCC3)c(OC)c([2H])c2n1 |
| InChI | InChI=1S/C22H24ClFN4O3/c1-29-20-13-19-16(12-21(20)31-8-2-5-28-6-9-30-10-7-28)22(26-14-25-19)27-15-3-4-18(24)17(23)11-15/h3-4,11-14H,2,5-10H2,1H3,(H,25,26,27)/i12D,13D,14D |
| InChIKey | XGALLCVXEZPNRQ-ZXLRRJFOSA-N |
| XLogP | 4.28 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|