C22H24ClFN4O3 — CID 46244016
N-(3-chloro-2,5,6-trideuterio-4-fluorophenyl)-7-methoxy-6-[3-(3,3,5,5-tetradeuteriomorpholin-4-yl)propoxy]quinazolin-4-amine (PubChem CID 46244016) has the molecular formula C22H24ClFN4O3 and a molecular weight of 453.95 g/mol. Its IUPAC name is N-(3-chloro-2,5,6-trideuterio-4-fluorophenyl)-7-methoxy-6-[3-(3,3,5,5-tetradeuteriomorpholin-4-yl)propoxy]quinazolin-4-amine.
| Compound Name | N-(3-chloro-2,5,6-trideuterio-4-fluorophenyl)-7-methoxy-6-[3-(3,3,5,5-tetradeuteriomorpholin-4-yl)propoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 46244016 |
| Molecular Formula | C22H24ClFN4O3 |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-(3-chloro-2,5,6-trideuterio-4-fluorophenyl)-7-methoxy-6-[3-(3,3,5,5-tetradeuteriomorpholin-4-yl)propoxy]quinazolin-4-amine |
| SMILES | [2H]c1c([2H])c(Nc2ncnc3cc(OC)c(OCCCN4C([2H])([2H])COCC4([2H])[2H])cc23)c([2H])c(Cl)c1F |
| InChI | InChI=1S/C22H24ClFN4O3/c1-29-20-13-19-16(12-21(20)31-8-2-5-28-6-9-30-10-7-28)22(26-14-25-19)27-15-3-4-18(24)17(23)11-15/h3-4,11-14H,2,5-10H2,1H3,(H,25,26,27)/i3D,4D,6D2,7D2,11D |
| InChIKey | XGALLCVXEZPNRQ-CRGNZCLTSA-N |
| XLogP | 4.28 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|