C23H27ClN4O4 — CID 51352657
N-[3-chloro-4-(trideuteriomethoxy)phenyl]-6-[3-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)propoxy]-7-(trideuteriomethoxy)quinazolin-4-amine (PubChem CID 51352657) has the molecular formula C23H27ClN4O4 and a molecular weight of 473.03 g/mol. Its IUPAC name is N-[3-chloro-4-(trideuteriomethoxy)phenyl]-6-[3-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)propoxy]-7-(trideuteriomethoxy)quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-(trideuteriomethoxy)phenyl]-6-[3-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)propoxy]-7-(trideuteriomethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 51352657 |
| Molecular Formula | C23H27ClN4O4 |
| Molecular Weight | 473.03 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[3-chloro-4-(trideuteriomethoxy)phenyl]-6-[3-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)propoxy]-7-(trideuteriomethoxy)quinazolin-4-amine |
| SMILES | [2H]C([2H])([2H])Oc1ccc(Nc2ncnc3cc(OC([2H])([2H])[2H])c(OCCCN4C([2H])([2H])C([2H])([2H])OC([2H])([2H])C4([2H])[2H])cc23)cc1Cl |
| InChI | InChI=1S/C23H27ClN4O4/c1-29-20-5-4-16(12-18(20)24)27-23-17-13-22(21(30-2)14-19(17)25-15-26-23)32-9-3-6-28-7-10-31-11-8-28/h4-5,12-15H,3,6-11H2,1-2H3,(H,25,26,27)/i1D3,2D3,7D2,8D2,10D2,11D2 |
| InChIKey | JUBCDKGMGZYLGX-QAHXOXPSSA-N |
| XLogP | 4.15 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.03 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|