C19H20N4S — CID 46256397
N-(2,6-dimethylphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide (PubChem CID 46256397) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide.
| Compound Name | N-(2,6-dimethylphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide |
|---|---|
| PubChem CID | 46256397 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)N1CCn2c(nc3ccccc32)C1 |
| InChI | InChI=1S/C19H20N4S/c1-13-6-5-7-14(2)18(13)21-19(24)22-10-11-23-16-9-4-3-8-15(16)20-17(23)12-22/h3-9H,10-12H2,1-2H3,(H,21,24) |
| InChIKey | QNYWYDDAVXXKAA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|