C25H26FN3O5S — CID 46284342
methyl 4-[7-[(4-fluorophenyl)methylcarbamoyl]-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate (PubChem CID 46284342) has the molecular formula C25H26FN3O5S and a molecular weight of 499.56 g/mol. Its IUPAC name is methyl 4-[7-[(4-fluorophenyl)methylcarbamoyl]-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate.
| Compound Name | methyl 4-[7-[(4-fluorophenyl)methylcarbamoyl]-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 46284342 |
| Molecular Formula | C25H26FN3O5S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | methyl 4-[7-[(4-fluorophenyl)methylcarbamoyl]-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)CSc1nc2cc(C(=O)NCc3ccc(F)cc3)ccc2c(=O)n1CC(C)C |
| InChI | InChI=1S/C25H26FN3O5S/c1-15(2)13-29-24(33)20-9-6-17(23(32)27-12-16-4-7-18(26)8-5-16)10-21(20)28-25(29)35-14-19(30)11-22(31)34-3/h4-10,15H,11-14H2,1-3H3,(H,27,32) |
| InChIKey | LXJWWFYNCUSUKB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|