C20H26N4O2S — CID 46295719
1-[6-(3-methoxyphenyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-3-carboxamide (PubChem CID 46295719) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[6-(3-methoxyphenyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-[6-(3-methoxyphenyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46295719 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[6-(3-methoxyphenyl)sulfanylpyridazin-3-yl]-N-propan-2-ylpiperidine-3-carboxamide |
| SMILES | COc1cccc(Sc2ccc(N3CCCC(C(=O)NC(C)C)C3)nn2)c1 |
| InChI | InChI=1S/C20H26N4O2S/c1-14(2)21-20(25)15-6-5-11-24(13-15)18-9-10-19(23-22-18)27-17-8-4-7-16(12-17)26-3/h4,7-10,12,14-15H,5-6,11,13H2,1-3H3,(H,21,25) |
| InChIKey | YYZYHGVYYNKCBG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |