C26H30N4O4S — CID 46322779
1-[3-butylsulfanyl-6-(2,3-dimethoxyphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 46322779) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[3-butylsulfanyl-6-(2,3-dimethoxyphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[3-butylsulfanyl-6-(2,3-dimethoxyphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 46322779 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 1-[3-butylsulfanyl-6-(2,3-dimethoxyphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCSc1nnc2c(n1)OC(c1cccc(OC)c1OC)N(C(C)=O)c1c(C)cc(C)cc1-2 |
| InChI | InChI=1S/C26H30N4O4S/c1-7-8-12-35-26-27-24-21(28-29-26)19-14-15(2)13-16(3)22(19)30(17(4)31)25(34-24)18-10-9-11-20(32-5)23(18)33-6/h9-11,13-14,25H,7-8,12H2,1-6H3 |
| InChIKey | XJKFJDHRMMGDOZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|