C19H23N3O4S — CID 4634599
N-(1-adamantylcarbamothioyl)-4-methoxy-3-nitrobenzamide (PubChem CID 4634599) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-(1-adamantylcarbamothioyl)-4-methoxy-3-nitrobenzamide.
| Compound Name | N-(1-adamantylcarbamothioyl)-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 4634599 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(1-adamantylcarbamothioyl)-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)NC23CC4CC(CC(C4)C2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N3O4S/c1-26-16-3-2-14(7-15(16)22(24)25)17(23)20-18(27)21-19-8-11-4-12(9-19)6-13(5-11)10-19/h2-3,7,11-13H,4-6,8-10H2,1H3,(H2,20,21,23,27) |
| InChIKey | LZMHQUATCBNPIH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|