C23H18N4OS2 — CID 4635996
3-[(1,3-diphenylpyrazol-4-yl)methyl]-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 4635996) has the molecular formula C23H18N4OS2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 3-[(1,3-diphenylpyrazol-4-yl)methyl]-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(1,3-diphenylpyrazol-4-yl)methyl]-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4635996 |
| Molecular Formula | C23H18N4OS2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 3-[(1,3-diphenylpyrazol-4-yl)methyl]-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc2c(=O)n(Cc3cn(-c4ccccc4)nc3-c3ccccc3)c(=S)[nH]c2s1 |
| InChI | InChI=1S/C23H18N4OS2/c1-15-12-19-21(30-15)24-23(29)26(22(19)28)13-17-14-27(18-10-6-3-7-11-18)25-20(17)16-8-4-2-5-9-16/h2-12,14H,13H2,1H3,(H,24,29) |
| InChIKey | BKIPRVXDDCXIJG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|