C21H22N5S2+ — CID 9331807
(1,3-diphenylpyrazol-4-yl)methyl-methyl-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]azanium (PubChem CID 9331807) has the molecular formula C21H22N5S2+ and a molecular weight of 408.58 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl-methyl-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]azanium.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl-methyl-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 9331807 |
| Molecular Formula | C21H22N5S2+ |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl-methyl-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]azanium |
| SMILES | Cc1nn(C[NH+](C)Cc2cn(-c3ccccc3)nc2-c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C21H21N5S2/c1-16-22-26(21(27)28-16)15-24(2)13-18-14-25(19-11-7-4-8-12-19)23-20(18)17-9-5-3-6-10-17/h3-12,14H,13,15H2,1-2H3/p+1 |
| InChIKey | UCLBAXRVLILOAK-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 40.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|