C20H23N3O3S — CID 8915178
3-[(1,3-diphenylpyrazol-4-yl)methyl-methylazaniumyl]propane-1-sulfonate (PubChem CID 8915178) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-[(1,3-diphenylpyrazol-4-yl)methyl-methylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[(1,3-diphenylpyrazol-4-yl)methyl-methylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 8915178 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-[(1,3-diphenylpyrazol-4-yl)methyl-methylazaniumyl]propane-1-sulfonate |
| SMILES | C[NH+](CCCS(=O)(=O)[O-])Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-22(13-8-14-27(24,25)26)15-18-16-23(19-11-6-3-7-12-19)21-20(18)17-9-4-2-5-10-17/h2-7,9-12,16H,8,13-15H2,1H3,(H,24,25,26) |
| InChIKey | NOXVODRINQGNBD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|