C20H21N4+ — CID 8915164
[(1S)-1-cyanoethyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium (PubChem CID 8915164) has the molecular formula C20H21N4+ and a molecular weight of 317.42 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium.
| Compound Name | [(1S)-1-cyanoethyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8915164 |
| Molecular Formula | C20H21N4+ |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [(1S)-1-cyanoethyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium |
| SMILES | C[C@@H](C#N)[NH+](C)Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H20N4/c1-16(13-21)23(2)14-18-15-24(19-11-7-4-8-12-19)22-20(18)17-9-5-3-6-10-17/h3-12,15-16H,14H2,1-2H3/p+1/t16-/m0/s1 |
| InChIKey | JQUGAZUNUAQNSE-INIZCTEOSA-O |
| XLogP | 2.47 |
| TPSA | 46.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |