C21H23N4+ — CID 8915213
[(2R)-2-cyanopropyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium (PubChem CID 8915213) has the molecular formula C21H23N4+ and a molecular weight of 331.44 g/mol. Its IUPAC name is [(2R)-2-cyanopropyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium.
| Compound Name | [(2R)-2-cyanopropyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8915213 |
| Molecular Formula | C21H23N4+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | [(2R)-2-cyanopropyl]-[(1,3-diphenylpyrazol-4-yl)methyl]-methylazanium |
| SMILES | C[C@@H](C#N)C[NH+](C)Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H22N4/c1-17(13-22)14-24(2)15-19-16-25(20-11-7-4-8-12-20)23-21(19)18-9-5-3-6-10-18/h3-12,16-17H,14-15H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | HRRNXCIWXHZNIR-KRWDZBQOSA-O |
| XLogP | 2.71 |
| TPSA | 46.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |