C15H14N2O3S — CID 46369319
4-(2-phenoxyethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 46369319) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 4-(2-phenoxyethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 4-(2-phenoxyethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 46369319 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-(2-phenoxyethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=S1(=O)N=CN(CCOc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H14N2O3S/c18-21(19)15-9-5-4-8-14(15)17(12-16-21)10-11-20-13-6-2-1-3-7-13/h1-9,12H,10-11H2 |
| InChIKey | BSYZAWFAABCNBJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |