C14H11BrN2O2S — CID 8669480
4-[(4-bromophenyl)methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 8669480) has the molecular formula C14H11BrN2O2S and a molecular weight of 351.23 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 4-[(4-bromophenyl)methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 8669480 |
| Molecular Formula | C14H11BrN2O2S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 4-[(4-bromophenyl)methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=S1(=O)N=CN(Cc2ccc(Br)cc2)c2ccccc21 |
| InChI | InChI=1S/C14H11BrN2O2S/c15-12-7-5-11(6-8-12)9-17-10-16-20(18,19)14-4-2-1-3-13(14)17/h1-8,10H,9H2 |
| InChIKey | SOKRLYYZXNXYNU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |