C25H25N3O4S — CID 46375725
4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 46375725) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46375725 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | CCn1c(=O)c(=O)n(Cc2ccc(C(=O)NCCSCc3ccco3)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H25N3O4S/c1-2-27-21-7-3-4-8-22(21)28(25(31)24(27)30)16-18-9-11-19(12-10-18)23(29)26-13-15-33-17-20-6-5-14-32-20/h3-12,14H,2,13,15-17H2,1H3,(H,26,29) |
| InChIKey | DPJJSTTYFZGEPN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|